Name | Cobalt (II) meso-tetraphenylporphine |
Synonyms | PROTOPORPHYRIN IX CO (II) (Tetraphenylporphinato)cobalt Cobalt(2+) tetraphenylporphinate Cobalt meso-tetraphenylporphyrin COBALT MESO-TETRAPHENYLPORPHYRIN Cobalt (II) meso-tetraphenylporphine Cobalt(II) alpha,beta,gamma,delta-tetraphenylporphine alpha,beta,gamma,delta-Tetraphenylporphinatocobalt(II) 21H,23H-Porphine, 5,10,15,20-tetraphenyl-, cobalt complex Cobalt, [5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N(21)-,N(22)-,N(23)-,N(24)-]-, (SP-4-1)- |
CAS | 14172-90-8 |
EINECS | 238-018-8 |
InChI | InChI=1/C44H28N4.Co/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
InChIKey | LSZLYWSRWXFMOI-DAJBKUBHSA-N |
Molecular Formula | C44H28CoN4 |
Molar Mass | 671.65 |
Density | 1.20 g/cm3 |
Melting Point | >300°C (dec.) |
Appearance | crystal |
Color | rust colored |
Maximum wavelength(λmax) | ['528nm(CH2Cl2)(lit.)'] |
Storage Condition | Inert atmosphere,Room Temperature |
Stability | Stable. Incompatible with strong oxidizing agents. |
WGK Germany | 3 |
HS Code | 29339900 |
Use | In the synthesis of asymmetric dihydrohepteptin substituents, it is used for the decomposition reaction of cycloheptatriene endoperoxide substituents |